NEET Chemistry Coordination Compounds MCQs

The IUPAC name of $CH_3CH_2Cl$ is:

What is the IUPAC name for $CH_3CH_2CH_2OH$?

What is the IUPAC name of $CH_3CH_2CHO$?

Which of the following is the correct IUPAC name for the compound with the structure CH3-CH2-CH(CH3)-CH2-C≡C-CH(C2H5)-CH3?

What is the correct IUPAC name for the compound represented by the structure: CH3-CH(CH3)-CH2-C(CH3)2-CH2-CH(C2H5)-CH2-CH3?

Name the compound: CH3-C(CH3)2-CH2-CH(CH(CH3)2)-CH2-CH3 according to IUPAC nomenclature.

What is the IUPAC name of the compound with the structure: CH3-CH=CH-CH2-C(C2H5)=CH-CH2-CH3?

Provide the IUPAC name for the spiro compound formed by connecting two cyclopentane rings at a single carbon atom.

What is the IUPAC name for a bicyclic compound consisting of two fused cyclohexane rings sharing two adjacent carbon atoms, with one methyl substituent on a shared carbon?

In an octahedral complex, the $d_{z^2}$ and $d_{x^2-y^2}$ orbitals are: